C12H21F3N2O2 — CID 114909001
N-ethyl-N-(3-hydroxypropyl)-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 114909001) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-ethyl-N-(3-hydroxypropyl)-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-ethyl-N-(3-hydroxypropyl)-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114909001 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-ethyl-N-(3-hydroxypropyl)-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | CCN(CCCO)C(=O)C1CCC(C(F)(F)F)CN1 |
| InChI | InChI=1S/C12H21F3N2O2/c1-2-17(6-3-7-18)11(19)10-5-4-9(8-16-10)12(13,14)15/h9-10,16,18H,2-8H2,1H3 |
| InChIKey | VYTIFVNDJHMOAW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |