C15H21N3OS — CID 114910040
3-[2-[1-(1-benzothiophen-2-yl)ethylamino]ethyl]-1,1-dimethylurea (PubChem CID 114910040) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 3-[2-[1-(1-benzothiophen-2-yl)ethylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[1-(1-benzothiophen-2-yl)ethylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 114910040 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-[2-[1-(1-benzothiophen-2-yl)ethylamino]ethyl]-1,1-dimethylurea |
| SMILES | CC(NCCNC(=O)N(C)C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H21N3OS/c1-11(16-8-9-17-15(19)18(2)3)14-10-12-6-4-5-7-13(12)20-14/h4-7,10-11,16H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | LUMANJURPOKKEF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|