About 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline
4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline (PubChem CID 114910160) has the molecular formula C17H12N2S2
and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline.
Molecular Properties
| Compound Name | 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline |
| PubChem CID | 114910160 |
| Molecular Formula | C17H12N2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(-c3cc4ccccc4s3)cs2)cc1 |
| InChI | InChI=1S/C17H12N2S2/c18-13-7-5-11(6-8-13)17-19-14(10-20-17)16-9-12-3-1-2-4-15(12)21-16/h1-10H,18H2 |
| InChIKey | WLPOOTLCLOCDLK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline?
The IUPAC name of 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline (CID 114910160) is 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline.
What is the SMILES notation for 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline?
The canonical SMILES for 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline is Nc1ccc(-c2nc(-c3cc4ccccc4s3)cs2)cc1.
What is the InChIKey of 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline?
The InChIKey is WLPOOTLCLOCDLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2S2/c18-13-7-5-11(6-8-13)17-19-14(10-20-17)16-9-12-3-1-2-4-15(12)21-16/h1-10H,18H2.
What are the key properties of 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline?
4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline has a molecular weight of 308.43 g/mol, XLogP of 5.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1-benzothiophen-2-yl)-1,3-thiazol-2-yl]aniline is sourced from PubChem (CID 114910160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).