C32H37F3N4O8S2 — CID 11491064
(2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoic acid (PubChem CID 11491064) has the molecular formula C32H37F3N4O8S2 and a molecular weight of 726.80 g/mol. Its IUPAC name is (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoic acid.
| Compound Name | (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 11491064 |
| Molecular Formula | C32H37F3N4O8S2 |
| Molecular Weight | 726.80 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | (2R)-5-[[amino-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylamino]pentanoic acid |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCC[C@@H](NS(=O)(=O)c2cc(F)c(Oc3ccc(F)cc3)c(F)c2)C(=O)O)c(C)c2c1OC(C)(C)CC2 |
| InChI | InChI=1S/C32H37F3N4O8S2/c1-17-18(2)29(19(3)23-12-13-32(4,5)47-27(17)23)49(44,45)39-31(36)37-14-6-7-26(30(40)41)38-48(42,43)22-15-24(34)28(25(35)16-22)46-21-10-8-20(33)9-11-21/h8-11,15-16,26,38H,6-7,12-14H2,1-5H3,(H,40,41)(H3,36,37,39)/t26-/m1/s1 |
| InChIKey | JYBAKYXMGYKNCH-AREMUKBSSA-N |
| XLogP | 4.73 |
| TPSA | 186.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|