C43H54O8SSi — CID 11491159
CID 11491159 (PubChem CID 11491159) has the molecular formula C43H54O8SSi and a molecular weight of 759.05 g/mol.
| Compound Name | CID 11491159 |
|---|---|
| PubChem CID | 11491159 |
| Molecular Formula | C43H54O8SSi |
| Molecular Weight | 759.05 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | — |
| SMILES | CO[C@H]1C[C@@H]2O[C@@]3(O[C@]4(C=CC[C@@H](/C=C/CCCO[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)O4)C[C@@H]3S(=O)(=O)c3ccccc3)[C@@H](C)C[C@@H]2O1 |
| InChI | InChI=1S/C43H54O8SSi/c1-32-29-37-38(30-40(46-5)48-37)50-43(32)39(52(44,45)34-21-11-6-12-22-34)31-42(51-43)27-18-20-33(49-42)19-10-9-17-28-47-53(41(2,3)4,35-23-13-7-14-24-35)36-25-15-8-16-26-36/h6-8,10-16,18-19,21-27,32-33,37-40H,9,17,20,28-31H2,1-5H3/b19-10+/t32-,33+,37-,38-,39-,40+,42+,43+/m0/s1 |
| InChIKey | NNULHNPTKGJOAE-DTZWTZGESA-N |
| XLogP | 7.09 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.05 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|