About 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide
6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide (PubChem CID 114912229) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide.
Molecular Properties
| Compound Name | 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide |
| PubChem CID | 114912229 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide |
| SMILES | CC(C)(CCN)CCC(=O)Nc1cnns1 |
| InChI | InChI=1S/C10H18N4OS/c1-10(2,5-6-11)4-3-8(15)13-9-7-12-14-16-9/h7H,3-6,11H2,1-2H3,(H,13,15) |
| InChIKey | WBYHZPJYLUGJKU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide?
The IUPAC name of 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide (CID 114912229) is 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide.
What is the SMILES notation for 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide?
The canonical SMILES for 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide is CC(C)(CCN)CCC(=O)Nc1cnns1.
What is the InChIKey of 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide?
The InChIKey is WBYHZPJYLUGJKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-10(2,5-6-11)4-3-8(15)13-9-7-12-14-16-9/h7H,3-6,11H2,1-2H3,(H,13,15).
What are the key properties of 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide?
6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide has a molecular weight of 242.35 g/mol, XLogP of 1.63, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4,4-dimethyl-N-(thiadiazol-5-yl)hexanamide is sourced from PubChem (CID 114912229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).