C25H43N5O2 — CID 11491247
N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-(butanoylamino)-3,4-dihydro-1H-naphthalene-2-carboxamide (PubChem CID 11491247) has the molecular formula C25H43N5O2 and a molecular weight of 445.65 g/mol. Its IUPAC name is N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-(butanoylamino)-3,4-dihydro-1H-naphthalene-2-carboxamide.
| Compound Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-(butanoylamino)-3,4-dihydro-1H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 11491247 |
| Molecular Formula | C25H43N5O2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.34 |
| IUPAC Name | N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-(butanoylamino)-3,4-dihydro-1H-naphthalene-2-carboxamide |
| SMILES | CCCC(=O)NC1(C(=O)NCCCNCCCCNCCCN)CCc2ccccc2C1 |
| InChI | InChI=1S/C25H43N5O2/c1-2-9-23(31)30-25(13-12-21-10-3-4-11-22(21)20-25)24(32)29-19-8-18-28-16-6-5-15-27-17-7-14-26/h3-4,10-11,27-28H,2,5-9,12-20,26H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | SZBBKBVEFNNLQZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|