C11H10N4O4S — CID 114913116
5-methoxy-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid (PubChem CID 114913116) has the molecular formula C11H10N4O4S and a molecular weight of 294.29 g/mol. Its IUPAC name is 5-methoxy-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid.
| Compound Name | 5-methoxy-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 114913116 |
| Molecular Formula | C11H10N4O4S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 5-methoxy-2-(thiadiazol-5-ylcarbamoylamino)benzoic acid |
| SMILES | COc1ccc(NC(=O)Nc2cnns2)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H10N4O4S/c1-19-6-2-3-8(7(4-6)10(16)17)13-11(18)14-9-5-12-15-20-9/h2-5H,1H3,(H,16,17)(H2,13,14,18) |
| InChIKey | QXDAEGHYFDWMSN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |