C43H82O5S2Si3 — CID 11491353
(2S,4R)-1-[2-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-4-[tert-butyl(dimethyl)silyl]oxy-6-methylideneoctan-2-ol (PubChem CID 11491353) has the molecular formula C43H82O5S2Si3 and a molecular weight of 827.52 g/mol. Its IUPAC name is (2S,4R)-1-[2-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-4-[tert-butyl(dimethyl)silyl]oxy-6-methylideneoctan-2-ol.
| Compound Name | (2S,4R)-1-[2-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-4-[tert-butyl(dimethyl)silyl]oxy-6-methylideneoctan-2-ol |
|---|---|
| PubChem CID | 11491353 |
| Molecular Formula | C43H82O5S2Si3 |
| Molecular Weight | 827.52 g/mol |
| Exact Mass | 826.49 |
| IUPAC Name | (2S,4R)-1-[2-[(2S,4R)-2,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-phenylmethoxypentyl]-1,3-dithian-2-yl]-4-[tert-butyl(dimethyl)silyl]oxy-6-methylideneoctan-2-ol |
| SMILES | C=C(CC)C[C@H](C[C@H](O)CC1(C[C@H](C[C@H](COCc2ccccc2)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C43H82O5S2Si3/c1-18-34(2)27-37(46-51(12,13)40(3,4)5)28-36(44)30-43(49-25-22-26-50-43)31-38(47-52(14,15)41(6,7)8)29-39(48-53(16,17)42(9,10)11)33-45-32-35-23-20-19-21-24-35/h19-21,23-24,36-39,44H,2,18,22,25-33H2,1,3-17H3/t36-,37+,38-,39+/m0/s1 |
| InChIKey | YARCWHVWWBDKNH-FHEXXAODSA-N |
| XLogP | 13.22 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.52 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|