C4H3N7OS — CID 114913673
N-(thiadiazol-5-yl)-2H-tetrazole-5-carboxamide (PubChem CID 114913673) has the molecular formula C4H3N7OS and a molecular weight of 197.18 g/mol. Its IUPAC name is N-(thiadiazol-5-yl)-2H-tetrazole-5-carboxamide.
| Compound Name | N-(thiadiazol-5-yl)-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 114913673 |
| Molecular Formula | C4H3N7OS |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | N-(thiadiazol-5-yl)-2H-tetrazole-5-carboxamide |
| SMILES | O=C(Nc1cnns1)c1nn[nH]n1 |
| InChI | InChI=1S/C4H3N7OS/c12-4(3-7-9-10-8-3)6-2-1-5-11-13-2/h1H,(H,6,12)(H,7,8,9,10) |
| InChIKey | MWQUAAYZDNKOQH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |