C9H6F3N5OS — CID 114914384
2-amino-N-(thiatriazol-5-yl)-5-(trifluoromethyl)benzamide (PubChem CID 114914384) has the molecular formula C9H6F3N5OS and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-amino-N-(thiatriazol-5-yl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-(thiatriazol-5-yl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 114914384 |
| Molecular Formula | C9H6F3N5OS |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-amino-N-(thiatriazol-5-yl)-5-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(=O)Nc1nnns1 |
| InChI | InChI=1S/C9H6F3N5OS/c10-9(11,12)4-1-2-6(13)5(3-4)7(18)14-8-15-16-17-19-8/h1-3H,13H2,(H,14,15,17,18) |
| InChIKey | ALXLURHARHHHLS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|