About 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine
4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine (PubChem CID 114916081) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine.
Molecular Properties
| Compound Name | 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine |
| PubChem CID | 114916081 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine |
| SMILES | Cc1csc(-c2nc3ncccc3o2)c1N |
| InChI | InChI=1S/C11H9N3OS/c1-6-5-16-9(8(6)12)11-14-10-7(15-11)3-2-4-13-10/h2-5H,12H2,1H3 |
| InChIKey | SPRMMTVEFRFWBB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine?
The IUPAC name of 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine (CID 114916081) is 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine.
What is the SMILES notation for 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine?
The canonical SMILES for 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine is Cc1csc(-c2nc3ncccc3o2)c1N.
What is the InChIKey of 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine?
The InChIKey is SPRMMTVEFRFWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3OS/c1-6-5-16-9(8(6)12)11-14-10-7(15-11)3-2-4-13-10/h2-5H,12H2,1H3.
What are the key properties of 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine?
4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine has a molecular weight of 231.28 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-([1,3]oxazolo[4,5-b]pyridin-2-yl)thiophen-3-amine is sourced from PubChem (CID 114916081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).