C13H11Cl2N3O — CID 114917283
2,5-dichloro-N-(1-pyridin-3-ylethyl)pyridine-4-carboxamide (PubChem CID 114917283) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-pyridin-3-ylethyl)pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-(1-pyridin-3-ylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114917283 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2,5-dichloro-N-(1-pyridin-3-ylethyl)pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)ncc1Cl)c1cccnc1 |
| InChI | InChI=1S/C13H11Cl2N3O/c1-8(9-3-2-4-16-6-9)18-13(19)10-5-12(15)17-7-11(10)14/h2-8H,1H3,(H,18,19) |
| InChIKey | AEOGRRMAWLFNDX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|