C12H16ClN3O3 — CID 114919353
5-chloro-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]pyridine-4-carboxylic acid (PubChem CID 114919353) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is 5-chloro-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 5-chloro-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 114919353 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-chloro-2-[methyl-[2-oxo-2-(propylamino)ethyl]amino]pyridine-4-carboxylic acid |
| SMILES | CCCNC(=O)CN(C)c1cc(C(=O)O)c(Cl)cn1 |
| InChI | InChI=1S/C12H16ClN3O3/c1-3-4-14-11(17)7-16(2)10-5-8(12(18)19)9(13)6-15-10/h5-6H,3-4,7H2,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | WBDBYBFDKDMNDO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |