About [(4E)-hexa-1,4-dien-3-yl] acetate
[(4E)-hexa-1,4-dien-3-yl] acetate (PubChem CID 11491947) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is [(4E)-hexa-1,4-dien-3-yl] acetate.
Molecular Properties
| Compound Name | [(4E)-hexa-1,4-dien-3-yl] acetate |
| PubChem CID | 11491947 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | [(4E)-hexa-1,4-dien-3-yl] acetate |
| SMILES | C=CC(/C=C/C)OC(C)=O |
| InChI | InChI=1S/C8H12O2/c1-4-6-8(5-2)10-7(3)9/h4-6,8H,2H2,1,3H3/b6-4+ |
| InChIKey | IVWWRPCMXAPSKX-GQCTYLIASA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-hexa-1,4-dien-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-hexa-1,4-dien-3-yl] acetate?
The IUPAC name of [(4E)-hexa-1,4-dien-3-yl] acetate (CID 11491947) is [(4E)-hexa-1,4-dien-3-yl] acetate.
What is the SMILES notation for [(4E)-hexa-1,4-dien-3-yl] acetate?
The canonical SMILES for [(4E)-hexa-1,4-dien-3-yl] acetate is C=CC(/C=C/C)OC(C)=O.
What is the InChIKey of [(4E)-hexa-1,4-dien-3-yl] acetate?
The InChIKey is IVWWRPCMXAPSKX-GQCTYLIASA-N. The full InChI is InChI=1S/C8H12O2/c1-4-6-8(5-2)10-7(3)9/h4-6,8H,2H2,1,3H3/b6-4+.
What are the key properties of [(4E)-hexa-1,4-dien-3-yl] acetate?
[(4E)-hexa-1,4-dien-3-yl] acetate has a molecular weight of 140.18 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-hexa-1,4-dien-3-yl] acetate is sourced from PubChem (CID 11491947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).