About 3-(2-aminoethyl)phenol
3-(2-aminoethyl)phenol (PubChem CID 11492) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 3-(2-aminoethyl)phenol.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)phenol |
| PubChem CID | 11492 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3-(2-aminoethyl)phenol |
| SMILES | NCCc1cccc(O)c1 |
| InChI | InChI=1S/C8H11NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4-5,9H2 |
| InChIKey | GHFGJTVYMNRGBY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-aminoethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)phenol?
The IUPAC name of 3-(2-aminoethyl)phenol (CID 11492) is 3-(2-aminoethyl)phenol.
What is the SMILES notation for 3-(2-aminoethyl)phenol?
The canonical SMILES for 3-(2-aminoethyl)phenol is NCCc1cccc(O)c1.
What is the InChIKey of 3-(2-aminoethyl)phenol?
The InChIKey is GHFGJTVYMNRGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4-5,9H2.
What are the key properties of 3-(2-aminoethyl)phenol?
3-(2-aminoethyl)phenol has a molecular weight of 137.18 g/mol, XLogP of 0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)phenol is sourced from PubChem (CID 11492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).