C13H19ClN2O — CID 114920404
[5-chloro-2-[cyclopentylmethyl(methyl)amino]-4-pyridinyl]methanol (PubChem CID 114920404) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is [5-chloro-2-[cyclopentylmethyl(methyl)amino]-4-pyridinyl]methanol.
| Compound Name | [5-chloro-2-[cyclopentylmethyl(methyl)amino]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 114920404 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [5-chloro-2-[cyclopentylmethyl(methyl)amino]-4-pyridinyl]methanol |
| SMILES | CN(CC1CCCC1)c1cc(CO)c(Cl)cn1 |
| InChI | InChI=1S/C13H19ClN2O/c1-16(8-10-4-2-3-5-10)13-6-11(9-17)12(14)7-15-13/h6-7,10,17H,2-5,8-9H2,1H3 |
| InChIKey | UJSBCZWBSSSVLI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |