C10H17NO2 — CID 11492056
3-(hydroxymethyl)-1,2,3,4,6,7,8,8a-octahydroisoquinolin-4-ol (PubChem CID 11492056) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,2,3,4,6,7,8,8a-octahydroisoquinolin-4-ol.
| Compound Name | 3-(hydroxymethyl)-1,2,3,4,6,7,8,8a-octahydroisoquinolin-4-ol |
|---|---|
| PubChem CID | 11492056 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-(hydroxymethyl)-1,2,3,4,6,7,8,8a-octahydroisoquinolin-4-ol |
| SMILES | OCC1NCC2CCCC=C2C1O |
| InChI | InChI=1S/C10H17NO2/c12-6-9-10(13)8-4-2-1-3-7(8)5-11-9/h4,7,9-13H,1-3,5-6H2 |
| InChIKey | VDEGPRRABZSWDU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|