C12H8ClF2NO2 — CID 114920716
[5-chloro-2-(2,3-difluorophenoxy)-4-pyridinyl]methanol (PubChem CID 114920716) has the molecular formula C12H8ClF2NO2 and a molecular weight of 271.65 g/mol. Its IUPAC name is [5-chloro-2-(2,3-difluorophenoxy)-4-pyridinyl]methanol.
| Compound Name | [5-chloro-2-(2,3-difluorophenoxy)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 114920716 |
| Molecular Formula | C12H8ClF2NO2 |
| Molecular Weight | 271.65 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | [5-chloro-2-(2,3-difluorophenoxy)-4-pyridinyl]methanol |
| SMILES | OCc1cc(Oc2cccc(F)c2F)ncc1Cl |
| InChI | InChI=1S/C12H8ClF2NO2/c13-8-5-16-11(4-7(8)6-17)18-10-3-1-2-9(14)12(10)15/h1-5,17H,6H2 |
| InChIKey | MMXFUALGQRPAHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |