C16H21Cl2NO — CID 114921331
5-chloro-4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine (PubChem CID 114921331) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 5-chloro-4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine.
| Compound Name | 5-chloro-4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine |
|---|---|
| PubChem CID | 114921331 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-chloro-4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine |
| SMILES | CC1(C)C2CCC1(C)C(Oc1cc(CCl)c(Cl)cn1)C2 |
| InChI | InChI=1S/C16H21Cl2NO/c1-15(2)11-4-5-16(15,3)13(7-11)20-14-6-10(8-17)12(18)9-19-14/h6,9,11,13H,4-5,7-8H2,1-3H3 |
| InChIKey | FQLZKZMJVDUQCZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|