About 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione
7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione (PubChem CID 11492190) has the molecular formula C10H10O5
and a molecular weight of 210.18 g/mol. Its IUPAC name is 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione.
Molecular Properties
| Compound Name | 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione |
| PubChem CID | 11492190 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione |
| SMILES | CCC1OC(=O)c2c(OC)cc(=O)oc21 |
| InChI | InChI=1S/C10H10O5/c1-3-5-9-8(10(12)14-5)6(13-2)4-7(11)15-9/h4-5H,3H2,1-2H3 |
| InChIKey | LAVJUISMIZTLGI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione?
The IUPAC name of 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione (CID 11492190) is 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione.
What is the SMILES notation for 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione?
The canonical SMILES for 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione is CCC1OC(=O)c2c(OC)cc(=O)oc21.
What is the InChIKey of 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione?
The InChIKey is LAVJUISMIZTLGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c1-3-5-9-8(10(12)14-5)6(13-2)4-7(11)15-9/h4-5H,3H2,1-2H3.
What are the key properties of 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione?
7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione has a molecular weight of 210.18 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4-methoxy-7H-furo[3,4-b]pyran-2,5-dione is sourced from PubChem (CID 11492190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).