C7H11Cl2NO2 — CID 11492198
2,2-dichloro-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone (PubChem CID 11492198) has the molecular formula C7H11Cl2NO2 and a molecular weight of 212.08 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone.
| Compound Name | 2,2-dichloro-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 11492198 |
| Molecular Formula | C7H11Cl2NO2 |
| Molecular Weight | 212.08 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 2,2-dichloro-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone |
| SMILES | CC1(C)OCCN1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C7H11Cl2NO2/c1-7(2)10(3-4-12-7)6(11)5(8)9/h5H,3-4H2,1-2H3 |
| InChIKey | FOMHMPJALXOZGZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.08 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|