C10H14O5 — CID 11492213
(4R,4aS,5R,7aS)-5-hydroxy-4,7-bis(hydroxymethyl)-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one (PubChem CID 11492213) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (4R,4aS,5R,7aS)-5-hydroxy-4,7-bis(hydroxymethyl)-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one.
| Compound Name | (4R,4aS,5R,7aS)-5-hydroxy-4,7-bis(hydroxymethyl)-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 11492213 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (4R,4aS,5R,7aS)-5-hydroxy-4,7-bis(hydroxymethyl)-4,4a,5,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one |
| SMILES | O=C1OC[C@@H]2C(CO)=C[C@H](O)[C@@H]2[C@@H]1CO |
| InChI | InChI=1S/C10H14O5/c11-2-5-1-8(13)9-6(3-12)10(14)15-4-7(5)9/h1,6-9,11-13H,2-4H2/t6-,7+,8-,9+/m0/s1 |
| InChIKey | VVELVVLHDHICNB-UYXSQOIJSA-N |
| XLogP | -1.32 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|