C11H14ClN3O — CID 114923292
5-chloro-N-cyclobutyl-2-(methylamino)pyridine-4-carboxamide (PubChem CID 114923292) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is 5-chloro-N-cyclobutyl-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-cyclobutyl-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114923292 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 5-chloro-N-cyclobutyl-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)NC2CCC2)c(Cl)cn1 |
| InChI | InChI=1S/C11H14ClN3O/c1-13-10-5-8(9(12)6-14-10)11(16)15-7-3-2-4-7/h5-7H,2-4H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | XQSZNAFMIBRRDH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |