About 1-butyl-3-methylimidazol-3-ium;methanesulfonate
1-butyl-3-methylimidazol-3-ium;methanesulfonate (PubChem CID 11492381) has the molecular formula C9H18N2O3S
and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-butyl-3-methylimidazol-3-ium;methanesulfonate.
Molecular Properties
| Compound Name | 1-butyl-3-methylimidazol-3-ium;methanesulfonate |
| PubChem CID | 11492381 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;methanesulfonate |
| SMILES | CCCCn1cc[n+](C)c1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H15N2.CH4O3S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | PUHVBRXUKOGSBC-UHFFFAOYSA-M |
| XLogP | 0.27 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-methylimidazol-3-ium;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-methylimidazol-3-ium;methanesulfonate?
The IUPAC name of 1-butyl-3-methylimidazol-3-ium;methanesulfonate (CID 11492381) is 1-butyl-3-methylimidazol-3-ium;methanesulfonate.
What is the SMILES notation for 1-butyl-3-methylimidazol-3-ium;methanesulfonate?
The canonical SMILES for 1-butyl-3-methylimidazol-3-ium;methanesulfonate is CCCCn1cc[n+](C)c1.CS(=O)(=O)[O-].
What is the InChIKey of 1-butyl-3-methylimidazol-3-ium;methanesulfonate?
The InChIKey is PUHVBRXUKOGSBC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H15N2.CH4O3S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of 1-butyl-3-methylimidazol-3-ium;methanesulfonate?
1-butyl-3-methylimidazol-3-ium;methanesulfonate has a molecular weight of 234.32 g/mol, XLogP of 0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-methylimidazol-3-ium;methanesulfonate is sourced from PubChem (CID 11492381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).