C16H24ClN3O — CID 114923849
5-chloro-2-(ethylamino)-N-(3-ethyl-2-methylcyclopentyl)pyridine-4-carboxamide (PubChem CID 114923849) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 5-chloro-2-(ethylamino)-N-(3-ethyl-2-methylcyclopentyl)pyridine-4-carboxamide.
| Compound Name | 5-chloro-2-(ethylamino)-N-(3-ethyl-2-methylcyclopentyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114923849 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 5-chloro-2-(ethylamino)-N-(3-ethyl-2-methylcyclopentyl)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NC2CCC(CC)C2C)c(Cl)cn1 |
| InChI | InChI=1S/C16H24ClN3O/c1-4-11-6-7-14(10(11)3)20-16(21)12-8-15(18-5-2)19-9-13(12)17/h8-11,14H,4-7H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | ZZOAFFZYYDHEMZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |