C16H26O — CID 11492385
(5R,6E)-6-[(7aR)-1,2,3,3a,4,7a-hexahydroinden-5-ylidene]-5-methylhexan-2-ol (PubChem CID 11492385) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (5R,6E)-6-[(7aR)-1,2,3,3a,4,7a-hexahydroinden-5-ylidene]-5-methylhexan-2-ol.
| Compound Name | (5R,6E)-6-[(7aR)-1,2,3,3a,4,7a-hexahydroinden-5-ylidene]-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 11492385 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (5R,6E)-6-[(7aR)-1,2,3,3a,4,7a-hexahydroinden-5-ylidene]-5-methylhexan-2-ol |
| SMILES | CC(O)CC[C@@H](C)/C=C1/C=C[C@@H]2CCCC2C1 |
| InChI | InChI=1S/C16H26O/c1-12(6-7-13(2)17)10-14-8-9-15-4-3-5-16(15)11-14/h8-10,12-13,15-17H,3-7,11H2,1-2H3/b14-10-/t12-,13?,15+,16?/m1/s1 |
| InChIKey | FKJXQFOWKUWOET-GIHYVBCPSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |