C16H22ClN3O — CID 114923871
2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[5-chloro-2-(ethylamino)-4-pyridinyl]methanone (PubChem CID 114923871) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[5-chloro-2-(ethylamino)-4-pyridinyl]methanone.
| Compound Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[5-chloro-2-(ethylamino)-4-pyridinyl]methanone |
|---|---|
| PubChem CID | 114923871 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl-[5-chloro-2-(ethylamino)-4-pyridinyl]methanone |
| SMILES | CCNc1cc(C(=O)N2CCCC3CCCC32)c(Cl)cn1 |
| InChI | InChI=1S/C16H22ClN3O/c1-2-18-15-9-12(13(17)10-19-15)16(21)20-8-4-6-11-5-3-7-14(11)20/h9-11,14H,2-8H2,1H3,(H,18,19) |
| InChIKey | VWJYGOLRQJUAHJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |