About 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione
1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione (PubChem CID 1149244) has the molecular formula C27H25N5O2
and a molecular weight of 451.53 g/mol. Its IUPAC name is 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione |
| PubChem CID | 1149244 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2)c(=O)c2c1nc(NCc1ccccc1)n2Cc1ccccc1 |
| InChI | InChI=1S/C27H25N5O2/c1-30-24-23(25(33)32(27(30)34)19-22-15-9-4-10-16-22)31(18-21-13-7-3-8-14-21)26(29-24)28-17-20-11-5-2-6-12-20/h2-16H,17-19H2,1H3,(H,28,29) |
| InChIKey | AZGPKKZZBMYLIZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione?
The IUPAC name of 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione (CID 1149244) is 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione.
What is the SMILES notation for 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione?
The canonical SMILES for 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione is Cn1c(=O)n(Cc2ccccc2)c(=O)c2c1nc(NCc1ccccc1)n2Cc1ccccc1.
What is the InChIKey of 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione?
The InChIKey is AZGPKKZZBMYLIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N5O2/c1-30-24-23(25(33)32(27(30)34)19-22-15-9-4-10-16-22)31(18-21-13-7-3-8-14-21)26(29-24)28-17-20-11-5-2-6-12-20/h2-16H,17-19H2,1H3,(H,28,29).
What are the key properties of 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione?
1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione has a molecular weight of 451.53 g/mol, XLogP of 3.61, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dibenzyl-8-(benzylamino)-3-methylpurine-2,6-dione is sourced from PubChem (CID 1149244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).