C13H20ClN3OS — CID 114924529
5-chloro-2-(ethylamino)-N-(2-methyl-2-methylsulfanylpropyl)pyridine-4-carboxamide (PubChem CID 114924529) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is 5-chloro-2-(ethylamino)-N-(2-methyl-2-methylsulfanylpropyl)pyridine-4-carboxamide.
| Compound Name | 5-chloro-2-(ethylamino)-N-(2-methyl-2-methylsulfanylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114924529 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-chloro-2-(ethylamino)-N-(2-methyl-2-methylsulfanylpropyl)pyridine-4-carboxamide |
| SMILES | CCNc1cc(C(=O)NCC(C)(C)SC)c(Cl)cn1 |
| InChI | InChI=1S/C13H20ClN3OS/c1-5-15-11-6-9(10(14)7-16-11)12(18)17-8-13(2,3)19-4/h6-7H,5,8H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | ZEHZULRVFVMDBE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |