About 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine
8-bromo-2,2-dimethyl-4H-1,3-benzodioxine (PubChem CID 11492460) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine |
| PubChem CID | 11492460 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine |
| SMILES | CC1(C)OCc2cccc(Br)c2O1 |
| InChI | InChI=1S/C10H11BrO2/c1-10(2)12-6-7-4-3-5-8(11)9(7)13-10/h3-5H,6H2,1-2H3 |
| InChIKey | UOHNNAOIKXQJCE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine?
The IUPAC name of 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine (CID 11492460) is 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine.
What is the SMILES notation for 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine?
The canonical SMILES for 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine is CC1(C)OCc2cccc(Br)c2O1.
What is the InChIKey of 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine?
The InChIKey is UOHNNAOIKXQJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-10(2)12-6-7-4-3-5-8(11)9(7)13-10/h3-5H,6H2,1-2H3.
What are the key properties of 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine?
8-bromo-2,2-dimethyl-4H-1,3-benzodioxine has a molecular weight of 243.10 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,2-dimethyl-4H-1,3-benzodioxine is sourced from PubChem (CID 11492460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).