C17H28ClN3 — CID 114925386
N-[[5-chloro-2-(2-ethylpiperidin-1-yl)-4-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 114925386) has the molecular formula C17H28ClN3 and a molecular weight of 309.88 g/mol. Its IUPAC name is N-[[5-chloro-2-(2-ethylpiperidin-1-yl)-4-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-chloro-2-(2-ethylpiperidin-1-yl)-4-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114925386 |
| Molecular Formula | C17H28ClN3 |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[[5-chloro-2-(2-ethylpiperidin-1-yl)-4-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCC1CCCCN1c1cc(CNC(C)(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C17H28ClN3/c1-5-14-8-6-7-9-21(14)16-10-13(15(18)12-19-16)11-20-17(2,3)4/h10,12,14,20H,5-9,11H2,1-4H3 |
| InChIKey | HRCWHWFRVVKMKJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |