About methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate
methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate (PubChem CID 11492603) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate |
| PubChem CID | 11492603 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc2[nH]c(-c3ccccc3)cc2s1 |
| InChI | InChI=1S/C14H11NO2S/c1-17-14(16)13-8-11-12(18-13)7-10(15-11)9-5-3-2-4-6-9/h2-8,15H,1H3 |
| InChIKey | MSLQQXYPTVSSCQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate?
The IUPAC name of methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate (CID 11492603) is methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate.
What is the SMILES notation for methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate?
The canonical SMILES for methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate is COC(=O)c1cc2[nH]c(-c3ccccc3)cc2s1.
What is the InChIKey of methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate?
The InChIKey is MSLQQXYPTVSSCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c1-17-14(16)13-8-11-12(18-13)7-10(15-11)9-5-3-2-4-6-9/h2-8,15H,1H3.
What are the key properties of methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate?
methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate has a molecular weight of 257.31 g/mol, XLogP of 3.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylate is sourced from PubChem (CID 11492603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).