C12H13BrClN3S — CID 114926094
4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylpyridin-2-amine (PubChem CID 114926094) has the molecular formula C12H13BrClN3S and a molecular weight of 346.68 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114926094 |
| Molecular Formula | C12H13BrClN3S |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 4-(aminomethyl)-N-[(5-bromothiophen-3-yl)methyl]-5-chloro-N-methylpyridin-2-amine |
| SMILES | CN(Cc1csc(Br)c1)c1cc(CN)c(Cl)cn1 |
| InChI | InChI=1S/C12H13BrClN3S/c1-17(6-8-2-11(13)18-7-8)12-3-9(4-15)10(14)5-16-12/h2-3,5,7H,4,6,15H2,1H3 |
| InChIKey | QPJRCCPIXRHDHR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |