C10H5N5O2S — CID 11492616
4-(furan-2-yl)-5-thia-2,3,7,10,11-pentazatricyclo[6.4.0.02,6]dodeca-1(8),3,6,11-tetraen-9-one (PubChem CID 11492616) has the molecular formula C10H5N5O2S and a molecular weight of 259.25 g/mol. Its IUPAC name is 4-(furan-2-yl)-5-thia-2,3,7,10,11-pentazatricyclo[6.4.0.02,6]dodeca-1(8),3,6,11-tetraen-9-one.
| Compound Name | 4-(furan-2-yl)-5-thia-2,3,7,10,11-pentazatricyclo[6.4.0.02,6]dodeca-1(8),3,6,11-tetraen-9-one |
|---|---|
| PubChem CID | 11492616 |
| Molecular Formula | C10H5N5O2S |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 4-(furan-2-yl)-5-thia-2,3,7,10,11-pentazatricyclo[6.4.0.02,6]dodeca-1(8),3,6,11-tetraen-9-one |
| SMILES | O=c1[nH]ncc2c1nc1sc(-c3ccco3)nn12 |
| InChI | InChI=1S/C10H5N5O2S/c16-8-7-5(4-11-13-8)15-10(12-7)18-9(14-15)6-2-1-3-17-6/h1-4H,(H,13,16) |
| InChIKey | XHVKXSFCPCEZSN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |