C13H17NO3Si — CID 11492657
(7S,8S,15S)-5,5-dimethyl-6,9-dioxa-11-aza-5-silatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2-dien-10-one (PubChem CID 11492657) has the molecular formula C13H17NO3Si and a molecular weight of 263.37 g/mol. Its IUPAC name is (7S,8S,15S)-5,5-dimethyl-6,9-dioxa-11-aza-5-silatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2-dien-10-one.
| Compound Name | (7S,8S,15S)-5,5-dimethyl-6,9-dioxa-11-aza-5-silatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2-dien-10-one |
|---|---|
| PubChem CID | 11492657 |
| Molecular Formula | C13H17NO3Si |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (7S,8S,15S)-5,5-dimethyl-6,9-dioxa-11-aza-5-silatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2-dien-10-one |
| SMILES | C[Si]1(C)CC=C2C3=CCCN4C(=O)O[C@H]([C@H]2O1)[C@H]34 |
| InChI | InChI=1S/C13H17NO3Si/c1-18(2)7-5-9-8-4-3-6-14-10(8)12(11(9)17-18)16-13(14)15/h4-5,10-12H,3,6-7H2,1-2H3/t10-,11-,12-/m0/s1 |
| InChIKey | AUFHQMVELXWGPU-SRVKXCTJSA-N |
| XLogP | 2.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|