C15H24ClN3 — CID 114926597
1-[5-chloro-2-(4-ethylazepan-1-yl)-4-pyridinyl]-N-methylmethanamine (PubChem CID 114926597) has the molecular formula C15H24ClN3 and a molecular weight of 281.83 g/mol. Its IUPAC name is 1-[5-chloro-2-(4-ethylazepan-1-yl)-4-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(4-ethylazepan-1-yl)-4-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114926597 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[5-chloro-2-(4-ethylazepan-1-yl)-4-pyridinyl]-N-methylmethanamine |
| SMILES | CCC1CCCN(c2cc(CNC)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C15H24ClN3/c1-3-12-5-4-7-19(8-6-12)15-9-13(10-17-2)14(16)11-18-15/h9,11-12,17H,3-8,10H2,1-2H3 |
| InChIKey | GJEZHYZLYDRPGG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |