C15H19N3OS — CID 114927077
2-amino-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-phenylbutanamide (PubChem CID 114927077) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-amino-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-phenylbutanamide.
| Compound Name | 2-amino-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 114927077 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-amino-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-phenylbutanamide |
| SMILES | Cc1csc(CNC(=O)C(N)CCc2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3OS/c1-11-10-20-14(18-11)9-17-15(19)13(16)8-7-12-5-3-2-4-6-12/h2-6,10,13H,7-9,16H2,1H3,(H,17,19) |
| InChIKey | FWNRWAOLCBUSGS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |