About N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide
N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide (PubChem CID 11492806) has the molecular formula C14H21N5O
and a molecular weight of 275.36 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide.
Molecular Properties
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide |
| PubChem CID | 11492806 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide |
| SMILES | CC(C)CN(NC(=O)C(C)(C)C)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C14H21N5O/c1-10(2)9-19(18-13(20)14(3,4)5)12-6-7-16-11(8-15)17-12/h6-7,10H,9H2,1-5H3,(H,18,20) |
| InChIKey | HPPWAAGQSSRKGO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide?
The IUPAC name of N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide (CID 11492806) is N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide.
What is the SMILES notation for N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide?
The canonical SMILES for N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide is CC(C)CN(NC(=O)C(C)(C)C)c1ccnc(C#N)n1.
What is the InChIKey of N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide?
The InChIKey is HPPWAAGQSSRKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O/c1-10(2)9-19(18-13(20)14(3,4)5)12-6-7-16-11(8-15)17-12/h6-7,10H,9H2,1-5H3,(H,18,20).
What are the key properties of N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide?
N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide has a molecular weight of 275.36 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanopyrimidin-4-yl)-2,2-dimethyl-N'-(2-methylpropyl)propanehydrazide is sourced from PubChem (CID 11492806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).