About 1,3,7-tripropylpurine-2,6-dione
1,3,7-tripropylpurine-2,6-dione (PubChem CID 11492842) has the molecular formula C14H22N4O2
and a molecular weight of 278.36 g/mol. Its IUPAC name is 1,3,7-tripropylpurine-2,6-dione.
Molecular Properties
| Compound Name | 1,3,7-tripropylpurine-2,6-dione |
| PubChem CID | 11492842 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1,3,7-tripropylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(ncn2CCC)n(CCC)c1=O |
| InChI | InChI=1S/C14H22N4O2/c1-4-7-16-10-15-12-11(16)13(19)18(9-6-3)14(20)17(12)8-5-2/h10H,4-9H2,1-3H3 |
| InChIKey | PMJKNRZFAZJNRA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3,7-tripropylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,7-tripropylpurine-2,6-dione?
The IUPAC name of 1,3,7-tripropylpurine-2,6-dione (CID 11492842) is 1,3,7-tripropylpurine-2,6-dione.
What is the SMILES notation for 1,3,7-tripropylpurine-2,6-dione?
The canonical SMILES for 1,3,7-tripropylpurine-2,6-dione is CCCn1c(=O)c2c(ncn2CCC)n(CCC)c1=O.
What is the InChIKey of 1,3,7-tripropylpurine-2,6-dione?
The InChIKey is PMJKNRZFAZJNRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2/c1-4-7-16-10-15-12-11(16)13(19)18(9-6-3)14(20)17(12)8-5-2/h10H,4-9H2,1-3H3.
What are the key properties of 1,3,7-tripropylpurine-2,6-dione?
1,3,7-tripropylpurine-2,6-dione has a molecular weight of 278.36 g/mol, XLogP of 1.59, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,7-tripropylpurine-2,6-dione is sourced from PubChem (CID 11492842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).