About 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate
2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate (PubChem CID 11492854) has the molecular formula C12H13N3O3S
and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate.
Molecular Properties
| Compound Name | 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate |
| PubChem CID | 11492854 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate |
| SMILES | Cc1nc(Nc2ccccc2)sc1CCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O3S/c1-9-11(7-8-18-15(16)17)19-12(13-9)14-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14) |
| InChIKey | AFPLOSAWSBMMIS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate?
The IUPAC name of 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate (CID 11492854) is 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate.
What is the SMILES notation for 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate?
The canonical SMILES for 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate is Cc1nc(Nc2ccccc2)sc1CCO[N+](=O)[O-].
What is the InChIKey of 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate?
The InChIKey is AFPLOSAWSBMMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3S/c1-9-11(7-8-18-15(16)17)19-12(13-9)14-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14).
What are the key properties of 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate?
2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate has a molecular weight of 279.32 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-anilino-4-methyl-1,3-thiazol-5-yl)ethyl nitrate is sourced from PubChem (CID 11492854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).