(3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate

C13H15Cl2NO2 — CID 114929192

IUPAC(3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate
SMILESCC1CCCC(OC(=O)c2cc(Cl)ncc2Cl)C1
InChIInChI=1S/C13H15Cl2NO2/c1-8-3-2-4-9(5-8)18-13(17)10-6-12(15)16-7-11(10)14/h6-9H,2-5H2,1H3
InChIKeyFFJIPAQOHGMFAL-UHFFFAOYSA-N
MW288.17 g/mol
LogP4.12
Rot. Bonds2

About (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate

(3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate (PubChem CID 114929192) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate.

Molecular Properties

Compound Name(3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate
PubChem CID114929192
Molecular FormulaC13H15Cl2NO2
Molecular Weight288.17 g/mol
Exact Mass287.05
IUPAC Name(3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate
SMILESCC1CCCC(OC(=O)c2cc(Cl)ncc2Cl)C1
InChIInChI=1S/C13H15Cl2NO2/c1-8-3-2-4-9(5-8)18-13(17)10-6-12(15)16-7-11(10)14/h6-9H,2-5H2,1H3
InChIKeyFFJIPAQOHGMFAL-UHFFFAOYSA-N
XLogP4.12
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.17
LogP ≤ 54.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate?
The IUPAC name of (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate (CID 114929192) is (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate.
What is the SMILES notation for (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate?
The canonical SMILES for (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate is CC1CCCC(OC(=O)c2cc(Cl)ncc2Cl)C1.
What is the InChIKey of (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate?
The InChIKey is FFJIPAQOHGMFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO2/c1-8-3-2-4-9(5-8)18-13(17)10-6-12(15)16-7-11(10)14/h6-9H,2-5H2,1H3.
What are the key properties of (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate?
(3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate has a molecular weight of 288.17 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 2,5-dichloropyridine-4-carboxylate is sourced from PubChem (CID 114929192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).