C19H30N2 — CID 114929669
1-(2-cyclopentylpyrrolidin-1-yl)-4-phenylbutan-2-amine (PubChem CID 114929669) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(2-cyclopentylpyrrolidin-1-yl)-4-phenylbutan-2-amine.
| Compound Name | 1-(2-cyclopentylpyrrolidin-1-yl)-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 114929669 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-(2-cyclopentylpyrrolidin-1-yl)-4-phenylbutan-2-amine |
| SMILES | NC(CCc1ccccc1)CN1CCCC1C1CCCC1 |
| InChI | InChI=1S/C19H30N2/c20-18(13-12-16-7-2-1-3-8-16)15-21-14-6-11-19(21)17-9-4-5-10-17/h1-3,7-8,17-19H,4-6,9-15,20H2 |
| InChIKey | LLGVKBSXLOXPOM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |