C9H13N4O3Zn- — CID 11493019
3-aminopropanoyl-[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]azanide;zinc (PubChem CID 11493019) has the molecular formula C9H13N4O3Zn- and a molecular weight of 290.62 g/mol. Its IUPAC name is 3-aminopropanoyl-[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]azanide;zinc.
| Compound Name | 3-aminopropanoyl-[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]azanide;zinc |
|---|---|
| PubChem CID | 11493019 |
| Molecular Formula | C9H13N4O3Zn- |
| Molecular Weight | 290.62 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 3-aminopropanoyl-[(1R)-1-carboxy-2-(1H-imidazol-5-yl)ethyl]azanide;zinc |
| SMILES | NCCC(=O)[N-][C@H](Cc1cnc[nH]1)C(=O)O.[Zn] |
| InChI | InChI=1S/C9H14N4O3.Zn/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6;/h4-5,7H,1-3,10H2,(H3,11,12,13,14,15,16);/p-1/t7-;/m1./s1 |
| InChIKey | GFWBKUDRXMQSFD-OGFXRTJISA-M |
| XLogP | -0.35 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.62 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|