C16H17F2N3 — CID 114930355
3-[[(2,6-difluorophenyl)methyl-methylamino]methyl]benzenecarboximidamide (PubChem CID 114930355) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-[[(2,6-difluorophenyl)methyl-methylamino]methyl]benzenecarboximidamide.
| Compound Name | 3-[[(2,6-difluorophenyl)methyl-methylamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 114930355 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[[(2,6-difluorophenyl)methyl-methylamino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CN(C)Cc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C16H17F2N3/c1-21(10-13-14(17)6-3-7-15(13)18)9-11-4-2-5-12(8-11)16(19)20/h2-8H,9-10H2,1H3,(H3,19,20) |
| InChIKey | COEDCWXZQVTDRE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|