About 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide
7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide (PubChem CID 114931643) has the molecular formula C16H16N4O
and a molecular weight of 280.33 g/mol. Its IUPAC name is 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide |
| PubChem CID | 114931643 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2cc3cccc(N)c3[nH]2)c1 |
| InChI | InChI=1S/C16H16N4O/c1-9-6-10(2)18-14(7-9)20-16(21)13-8-11-4-3-5-12(17)15(11)19-13/h3-8,19H,17H2,1-2H3,(H,18,20,21) |
| InChIKey | XJFPVJZFWOCYHB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide?
The IUPAC name of 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide (CID 114931643) is 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide.
What is the SMILES notation for 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide?
The canonical SMILES for 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide is Cc1cc(C)nc(NC(=O)c2cc3cccc(N)c3[nH]2)c1.
What is the InChIKey of 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide?
The InChIKey is XJFPVJZFWOCYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O/c1-9-6-10(2)18-14(7-9)20-16(21)13-8-11-4-3-5-12(17)15(11)19-13/h3-8,19H,17H2,1-2H3,(H,18,20,21).
What are the key properties of 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide?
7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide has a molecular weight of 280.33 g/mol, XLogP of 3.01, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-N-(4,6-dimethyl-2-pyridinyl)-1H-indole-2-carboxamide is sourced from PubChem (CID 114931643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).