About 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide
7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide (PubChem CID 11493181) has the molecular formula C17H35NO3
and a molecular weight of 301.47 g/mol. Its IUPAC name is 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide.
Molecular Properties
| Compound Name | 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide |
| PubChem CID | 11493181 |
| Molecular Formula | C17H35NO3 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide |
| SMILES | CC(C)(CO)CCCCNC(=O)CCCCC(C)(C)CO |
| InChI | InChI=1S/C17H35NO3/c1-16(2,13-19)10-6-5-9-15(21)18-12-8-7-11-17(3,4)14-20/h19-20H,5-14H2,1-4H3,(H,18,21) |
| InChIKey | YZALCABZQQRLJS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide?
The IUPAC name of 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide (CID 11493181) is 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide.
What is the SMILES notation for 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide?
The canonical SMILES for 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide is CC(C)(CO)CCCCNC(=O)CCCCC(C)(C)CO.
What is the InChIKey of 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide?
The InChIKey is YZALCABZQQRLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO3/c1-16(2,13-19)10-6-5-9-15(21)18-12-8-7-11-17(3,4)14-20/h19-20H,5-14H2,1-4H3,(H,18,21).
What are the key properties of 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide?
7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide has a molecular weight of 301.47 g/mol, XLogP of 2.87, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-N-(6-hydroxy-5,5-dimethylhexyl)-6,6-dimethylheptanamide is sourced from PubChem (CID 11493181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).