C16H25F2NO — CID 114932658
1-(2,6-difluorophenyl)-3-ethoxy-N-ethyl-4-methylpentan-2-amine (PubChem CID 114932658) has the molecular formula C16H25F2NO and a molecular weight of 285.38 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-ethoxy-N-ethyl-4-methylpentan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-3-ethoxy-N-ethyl-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 114932658 |
| Molecular Formula | C16H25F2NO |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-ethoxy-N-ethyl-4-methylpentan-2-amine |
| SMILES | CCNC(Cc1c(F)cccc1F)C(OCC)C(C)C |
| InChI | InChI=1S/C16H25F2NO/c1-5-19-15(16(11(3)4)20-6-2)10-12-13(17)8-7-9-14(12)18/h7-9,11,15-16,19H,5-6,10H2,1-4H3 |
| InChIKey | QKKQGXOSPNORKJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |