About methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate
methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate (PubChem CID 11493366) has the molecular formula C14H15FO5S
and a molecular weight of 314.33 g/mol. Its IUPAC name is methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate |
| PubChem CID | 11493366 |
| Molecular Formula | C14H15FO5S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate |
| SMILES | COC(=O)[C@@H](F)[C@@H]1C=CC[C@H]1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15FO5S/c1-19-14(16)13(15)11-8-5-9-12(11)20-21(17,18)10-6-3-2-4-7-10/h2-8,11-13H,9H2,1H3/t11-,12-,13+/m1/s1 |
| InChIKey | NBVJSGWETMJDTC-UPJWGTAASA-N |
| XLogP | 1.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate?
The IUPAC name of methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate (CID 11493366) is methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate.
What is the SMILES notation for methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate?
The canonical SMILES for methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate is COC(=O)[C@@H](F)[C@@H]1C=CC[C@H]1OS(=O)(=O)c1ccccc1.
What is the InChIKey of methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate?
The InChIKey is NBVJSGWETMJDTC-UPJWGTAASA-N. The full InChI is InChI=1S/C14H15FO5S/c1-19-14(16)13(15)11-8-5-9-12(11)20-21(17,18)10-6-3-2-4-7-10/h2-8,11-13H,9H2,1H3/t11-,12-,13+/m1/s1.
What are the key properties of methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate?
methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate has a molecular weight of 314.33 g/mol, XLogP of 1.85, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(1R,5R)-5-(benzenesulfonyloxy)cyclopent-2-en-1-yl]-2-fluoroacetate is sourced from PubChem (CID 11493366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).