C14H16N2 — CID 114933796
4,6-dimethyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene (PubChem CID 114933796) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 4,6-dimethyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene.
| Compound Name | 4,6-dimethyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 114933796 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 4,6-dimethyl-3,9-diazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene |
| SMILES | Cc1cc(C)n2c3c(nc2c1)C1CCC3C1 |
| InChI | InChI=1S/C14H16N2/c1-8-5-9(2)16-12(6-8)15-13-10-3-4-11(7-10)14(13)16/h5-6,10-11H,3-4,7H2,1-2H3 |
| InChIKey | KQTFKYVEMCEWGJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |